Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Gold wire, 0.5mm (0.02in) dia, 99.95% (metals basis)
CAS: 7440-57-5 Molecular Formula: Au Molecular Weight (g/mol): 196.97 MDL Number: MFCD00003436 InChI Key: PCHJSUWPFVWCPO-UHFFFAOYSA-N Synonym: colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 PubChem CID: 23985 ChEBI: CHEBI:30050 IUPAC Name: gold SMILES: [Au]
| PubChem CID | 23985 |
|---|---|
| CAS | 7440-57-5 |
| Molecular Weight (g/mol) | 196.97 |
| ChEBI | CHEBI:30050 |
| MDL Number | MFCD00003436 |
| SMILES | [Au] |
| Synonym | colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 |
| IUPAC Name | gold |
| InChI Key | PCHJSUWPFVWCPO-UHFFFAOYSA-N |
| Molecular Formula | Au |
Strontium nitrate, Puratronic™, 99.9965% (metals basis)
CAS: 10042-76-9 Molecular Formula: N2O6Sr Molecular Weight (g/mol): 211.63 MDL Number: MFCD00011248 InChI Key: DHEQXMRUPNDRPG-UHFFFAOYSA-N Synonym: strontium nitrate,strontium dinitrate,nitric acid, strontium salt,strontium ii nitrate 1:2,unii-bdg873aqzl,nitrate de strontium french,hsdb 787,strontium nitrate sr no3 2,bdg873aqzl,nitric acid, strontium salt 2:1 PubChem CID: 24848 SMILES: [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24848 |
|---|---|
| CAS | 10042-76-9 |
| Molecular Weight (g/mol) | 211.63 |
| MDL Number | MFCD00011248 |
| SMILES | [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | strontium nitrate,strontium dinitrate,nitric acid, strontium salt,strontium ii nitrate 1:2,unii-bdg873aqzl,nitrate de strontium french,hsdb 787,strontium nitrate sr no3 2,bdg873aqzl,nitric acid, strontium salt 2:1 |
| InChI Key | DHEQXMRUPNDRPG-UHFFFAOYSA-N |
| Molecular Formula | N2O6Sr |
Osmium powder, -20 mesh, 99.95% (metals basis)
CAS: 4-2-7440 PubChem CID: 23937 ChEBI: CHEBI:30687 IUPAC Name: osmium
| PubChem CID | 23937 |
|---|---|
| CAS | 4-2-7440 |
| ChEBI | CHEBI:30687 |
| IUPAC Name | osmium |
Aluminum chloride hexahydrate, Reagent Grade
CAS: 7784-13-6 Molecular Formula: AlCl3H12O6 Molecular Weight (g/mol): 241.42 MDL Number: MFCD00149134 InChI Key: JGDITNMASUZKPW-UHFFFAOYSA-K SMILES: O.O.O.O.O.O.[Al+3].[Cl-].[Cl-].[Cl-]
| CAS | 7784-13-6 |
|---|---|
| Molecular Weight (g/mol) | 241.42 |
| MDL Number | MFCD00149134 |
| SMILES | O.O.O.O.O.O.[Al+3].[Cl-].[Cl-].[Cl-] |
| InChI Key | JGDITNMASUZKPW-UHFFFAOYSA-K |
| Molecular Formula | AlCl3H12O6 |
Barium iodide hydrate, 95%
CAS: 13718-50-8 Molecular Formula: BaI2 Molecular Weight (g/mol): 391.14 MDL Number: MFCD00003452 InChI Key: SGUXGJPBTNFBAD-UHFFFAOYSA-L IUPAC Name: barium(2+) diiodide SMILES: [I-].[I-].[Ba++]
| CAS | 13718-50-8 |
|---|---|
| Molecular Weight (g/mol) | 391.14 |
| MDL Number | MFCD00003452 |
| SMILES | [I-].[I-].[Ba++] |
| IUPAC Name | barium(2+) diiodide |
| InChI Key | SGUXGJPBTNFBAD-UHFFFAOYSA-L |
| Molecular Formula | BaI2 |
Sodium Phosphate Dibasic, MP Biomedicals™
CAS: 7558-79-4 Molecular Formula: HNa2O4P Molecular Weight (g/mol): 141.96 MDL Number: MFCD00003496 InChI Key: BNIILDVGGAEEIG-UHFFFAOYSA-L Synonym: disodium hydrogen phosphate,disodium phosphate,disodium hydrogenorthophosphate,sodium phosphate dibasic,dibasic sodium phosphate,acetest,soda phosphate,disodium orthophosphate,sodium hydrogen phosphate,phosphoric acid, disodium salt PubChem CID: 24203 ChEBI: CHEBI:34683 SMILES: [Na+].[Na+].OP([O-])([O-])=O
| PubChem CID | 24203 |
|---|---|
| CAS | 7558-79-4 |
| Molecular Weight (g/mol) | 141.96 |
| ChEBI | CHEBI:34683 |
| MDL Number | MFCD00003496 |
| SMILES | [Na+].[Na+].OP([O-])([O-])=O |
| Synonym | disodium hydrogen phosphate,disodium phosphate,disodium hydrogenorthophosphate,sodium phosphate dibasic,dibasic sodium phosphate,acetest,soda phosphate,disodium orthophosphate,sodium hydrogen phosphate,phosphoric acid, disodium salt |
| InChI Key | BNIILDVGGAEEIG-UHFFFAOYSA-L |
| Molecular Formula | HNa2O4P |
Cesium acetate, 99.998% (metals basis)
CAS: 3396-11-0 Molecular Formula: C2H3CsO2 Molecular Weight (g/mol): 191.949 MDL Number: MFCD00013056 InChI Key: ZOAIGCHJWKDIPJ-UHFFFAOYSA-M Synonym: cesium acetate,acetic acid, cesium salt,caesium acetate,acetic acid, cesium salt 1:1,acetic acid, cesiumsalt,acetic acid cesium salt,caesium 1+ ion acetate,cesiumacetate,acetic acid cesium,caesium 1+ acetate ion PubChem CID: 5152919 IUPAC Name: cesium;acetate SMILES: CC(=O)[O-].[Cs+]
| PubChem CID | 5152919 |
|---|---|
| CAS | 3396-11-0 |
| Molecular Weight (g/mol) | 191.949 |
| MDL Number | MFCD00013056 |
| SMILES | CC(=O)[O-].[Cs+] |
| Synonym | cesium acetate,acetic acid, cesium salt,caesium acetate,acetic acid, cesium salt 1:1,acetic acid, cesiumsalt,acetic acid cesium salt,caesium 1+ ion acetate,cesiumacetate,acetic acid cesium,caesium 1+ acetate ion |
| IUPAC Name | cesium;acetate |
| InChI Key | ZOAIGCHJWKDIPJ-UHFFFAOYSA-M |
| Molecular Formula | C2H3CsO2 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, tetrasodium salt hydrate, 98%, pure
CAS: 194491-31-1 Molecular Formula: C10H12N2Na4O8 Molecular Weight (g/mol): 380.17 MDL Number: MFCD00150025 InChI Key: UEUXEKPTXMALOB-UHFFFAOYSA-J Synonym: edta tetrasodium salt,ethylenediaminetetraacetic acid tetrasodium salt hydrate,tetrasodium 2-2-bis carboxylatomethyl amino ethyl carboxylatomethyl amino acetate hydrate,tetrasodium ion 4-edta hydrate,ethylenediaminetetraacetic acid, tetrasodium salt hydrate,ethylenediaminetetraacetic acid tetrasodium salt hydrate kt,ethylenediaminetetraacetic acid tetrasodium salt hydrate, bioultra kt,ethylenediaminetetraacetic acid tetrasodium salt hydrate, practical grade PubChem CID: 16211056 SMILES: [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 16211056 |
|---|---|
| CAS | 194491-31-1 |
| Molecular Weight (g/mol) | 380.17 |
| MDL Number | MFCD00150025 |
| SMILES | [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta tetrasodium salt,ethylenediaminetetraacetic acid tetrasodium salt hydrate,tetrasodium 2-2-bis carboxylatomethyl amino ethyl carboxylatomethyl amino acetate hydrate,tetrasodium ion 4-edta hydrate,ethylenediaminetetraacetic acid, tetrasodium salt hydrate,ethylenediaminetetraacetic acid tetrasodium salt hydrate kt,ethylenediaminetetraacetic acid tetrasodium salt hydrate, bioultra kt,ethylenediaminetetraacetic acid tetrasodium salt hydrate, practical grade |
| InChI Key | UEUXEKPTXMALOB-UHFFFAOYSA-J |
| Molecular Formula | C10H12N2Na4O8 |
Acetic acid, potassium salt, 99+%, pure, anhydrous
CAS: 127-08-2 Molecular Formula: C2H3KO2 Molecular Weight (g/mol): 98.14 MDL Number: MFCD00012458 InChI Key: SCVFZCLFOSHCOH-UHFFFAOYSA-M Synonym: potassium acetate,acetic acid, potassium salt,diuretic salt,potassium ethanoate,koac,octan draselny czech,potassiumacetate,acetic acid potassium salt,acok,fema no. 2920 PubChem CID: 517044 ChEBI: CHEBI:32029 IUPAC Name: potassium;acetate SMILES: CC(=O)[O-].[K+]
| PubChem CID | 517044 |
|---|---|
| CAS | 127-08-2 |
| Molecular Weight (g/mol) | 98.14 |
| ChEBI | CHEBI:32029 |
| MDL Number | MFCD00012458 |
| SMILES | CC(=O)[O-].[K+] |
| Synonym | potassium acetate,acetic acid, potassium salt,diuretic salt,potassium ethanoate,koac,octan draselny czech,potassiumacetate,acetic acid potassium salt,acok,fema no. 2920 |
| IUPAC Name | potassium;acetate |
| InChI Key | SCVFZCLFOSHCOH-UHFFFAOYSA-M |
| Molecular Formula | C2H3KO2 |
Ammonium nitrate, 99.999%, (trace metal basis), Thermo Scientific Chemicals
CAS: 6484-52-2 Molecular Formula: H4N2O3 Molecular Weight (g/mol): 80.04 MDL Number: MFCD00011425 InChI Key: DVARTQFDIMZBAA-UHFFFAOYSA-O Synonym: ammonium nitrate,nitram,ammonium nitricum,ammonium saltpeter,nitrate of ammonia,nitric acid ammonium salt,nitrato amonico,herco prills,german saltpeter,merco prills PubChem CID: 22985 ChEBI: CHEBI:63038 IUPAC Name: ammonium nitrate SMILES: [NH4+].[O-][N+]([O-])=O
| PubChem CID | 22985 |
|---|---|
| CAS | 6484-52-2 |
| Molecular Weight (g/mol) | 80.04 |
| ChEBI | CHEBI:63038 |
| MDL Number | MFCD00011425 |
| SMILES | [NH4+].[O-][N+]([O-])=O |
| Synonym | ammonium nitrate,nitram,ammonium nitricum,ammonium saltpeter,nitrate of ammonia,nitric acid ammonium salt,nitrato amonico,herco prills,german saltpeter,merco prills |
| IUPAC Name | ammonium nitrate |
| InChI Key | DVARTQFDIMZBAA-UHFFFAOYSA-O |
| Molecular Formula | H4N2O3 |
Lithium hexafluorophosphate, 98%
CAS: 21324-40-3 Molecular Formula: F6LiP Molecular Weight (g/mol): 151.904 MDL Number: MFCD00011096 InChI Key: AXPLOJNSKRXQPA-UHFFFAOYSA-N Synonym: lithium hexafluorophosphate,lithium hexafluorophosphate v,phosphate 1-, hexafluoro-, lithium,phosphate 1-, hexafluoro-, lithium 1:1,lithiumhexafluorophosphate,lithium hexafluorophosphate 1-,lipf6,lithium hexafluoroposphate,acmc-209fj7,ksc492g4h PubChem CID: 23688915 IUPAC Name: lithium;hexafluorophosphate SMILES: [Li+].F[P-](F)(F)(F)(F)F
| PubChem CID | 23688915 |
|---|---|
| CAS | 21324-40-3 |
| Molecular Weight (g/mol) | 151.904 |
| MDL Number | MFCD00011096 |
| SMILES | [Li+].F[P-](F)(F)(F)(F)F |
| Synonym | lithium hexafluorophosphate,lithium hexafluorophosphate v,phosphate 1-, hexafluoro-, lithium,phosphate 1-, hexafluoro-, lithium 1:1,lithiumhexafluorophosphate,lithium hexafluorophosphate 1-,lipf6,lithium hexafluoroposphate,acmc-209fj7,ksc492g4h |
| IUPAC Name | lithium;hexafluorophosphate |
| InChI Key | AXPLOJNSKRXQPA-UHFFFAOYSA-N |
| Molecular Formula | F6LiP |
Aluminum Foil, 0.1mm (0.004 in.) thick, Puratronic™, 99.997% (Metals basis)
CAS: 7429-90-5 Molecular Formula: Al Molecular Weight (g/mol): 26.98 MDL Number: MFCD00134029 InChI Key: XAGFODPZIPBFFR-UHFFFAOYSA-N Synonym: aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum PubChem CID: 5359268 ChEBI: CHEBI:33629 SMILES: [Al]
| PubChem CID | 5359268 |
|---|---|
| CAS | 7429-90-5 |
| Molecular Weight (g/mol) | 26.98 |
| ChEBI | CHEBI:33629 |
| MDL Number | MFCD00134029 |
| SMILES | [Al] |
| Synonym | aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum |
| InChI Key | XAGFODPZIPBFFR-UHFFFAOYSA-N |
| Molecular Formula | Al |
Lithium wire, 3.2mm (0.125in) dia, 99.8%, Na 0.03% max
CAS: 7439-93-2 Molecular Formula: Li Molecular Weight (g/mol): 6.94 MDL Number: MFCD00134051 InChI Key: WHXSMMKQMYFTQS-UHFFFAOYSA-N Synonym: litio,litium,lithium, metallic,lithium, elemental,monohydride,unii-9fn79x2m3f,hsdb 647,hydride lih,hydrure de french,hsdb 549 PubChem CID: 3028194 ChEBI: CHEBI:30145 IUPAC Name: lithium SMILES: [Li]
| PubChem CID | 3028194 |
|---|---|
| CAS | 7439-93-2 |
| Molecular Weight (g/mol) | 6.94 |
| ChEBI | CHEBI:30145 |
| MDL Number | MFCD00134051 |
| SMILES | [Li] |
| Synonym | litio,litium,lithium, metallic,lithium, elemental,monohydride,unii-9fn79x2m3f,hsdb 647,hydride lih,hydrure de french,hsdb 549 |
| IUPAC Name | lithium |
| InChI Key | WHXSMMKQMYFTQS-UHFFFAOYSA-N |
| Molecular Formula | Li |
Barium nitrate, ACS, 99+%
CAS: 10022-31-8 Molecular Formula: BaN2O6 Molecular Weight (g/mol): 261.34 MDL Number: MFCD00003442 InChI Key: IWOUKMZUPDVPGQ-UHFFFAOYSA-N Synonym: barium nitrate,nitrobarite,nitric acid, barium salt,barium dinitrate,bariumnitrate,dusicnan barnaty czech,nitrato barico spanish,unii-mdc5sw56xc,nitrate de baryum french,barium nitrate ba no3 2 PubChem CID: 24798 SMILES: [Ba++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24798 |
|---|---|
| CAS | 10022-31-8 |
| Molecular Weight (g/mol) | 261.34 |
| MDL Number | MFCD00003442 |
| SMILES | [Ba++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | barium nitrate,nitrobarite,nitric acid, barium salt,barium dinitrate,bariumnitrate,dusicnan barnaty czech,nitrato barico spanish,unii-mdc5sw56xc,nitrate de baryum french,barium nitrate ba no3 2 |
| InChI Key | IWOUKMZUPDVPGQ-UHFFFAOYSA-N |
| Molecular Formula | BaN2O6 |
Iron(II) bromide, ultra dry, 99.995% (metals basis), Thermo Scientific Chemicals
CAS: 7789-46-0 Molecular Formula: Br2Fe Molecular Weight (g/mol): 215.65 MDL Number: MFCD00016081 InChI Key: GYCHYNMREWYSKH-UHFFFAOYSA-L Synonym: iron dibromide,unii-ea3x054rbz,iron ii bromide,ea3x054rbz,iron 2+ dibromide,iron ion 2+ dibromide,iron ii bromide, anhydrous 5g,iron ii bromide, ultra dry metals basis,ferrous bromide, anhydrous PubChem CID: 82240 IUPAC Name: iron(2+);dibromide SMILES: [Fe++].[Br-].[Br-]
| PubChem CID | 82240 |
|---|---|
| CAS | 7789-46-0 |
| Molecular Weight (g/mol) | 215.65 |
| MDL Number | MFCD00016081 |
| SMILES | [Fe++].[Br-].[Br-] |
| Synonym | iron dibromide,unii-ea3x054rbz,iron ii bromide,ea3x054rbz,iron 2+ dibromide,iron ion 2+ dibromide,iron ii bromide, anhydrous 5g,iron ii bromide, ultra dry metals basis,ferrous bromide, anhydrous |
| IUPAC Name | iron(2+);dibromide |
| InChI Key | GYCHYNMREWYSKH-UHFFFAOYSA-L |
| Molecular Formula | Br2Fe |